About 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine
4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine (PubChem CID 135342090) has the molecular formula C10H13F3N4O3
and a molecular weight of 294.23 g/mol. Its IUPAC name is 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine.
Molecular Properties
| Compound Name | 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine |
| PubChem CID | 135342090 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine |
| SMILES | O=[N+]([O-])c1cn(C2CCNCC2)nc1OCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3/c11-10(12,13)6-20-9-8(17(18)19)5-16(15-9)7-1-3-14-4-2-7/h5,7,14H,1-4,6H2 |
| InChIKey | PJZVJJPYSPVQLP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine?
The IUPAC name of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine (CID 135342090) is 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine.
What is the SMILES notation for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine?
The canonical SMILES for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine is O=[N+]([O-])c1cn(C2CCNCC2)nc1OCC(F)(F)F.
What is the InChIKey of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine?
The InChIKey is PJZVJJPYSPVQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N4O3/c11-10(12,13)6-20-9-8(17(18)19)5-16(15-9)7-1-3-14-4-2-7/h5,7,14H,1-4,6H2.
What are the key properties of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine?
4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine has a molecular weight of 294.23 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidine is sourced from PubChem (CID 135342090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).