C23H25FN8O2S — CID 135342562
6-(5-amino-4-methyl-3-pyridinyl)-3-N-(6,6-dioxo-5-propan-2-yl-4,7-dihydropyrazolo[5,1-d][1,2,5]thiadiazin-2-yl)-7-fluoroisoquinoline-3,8-diamine (PubChem CID 135342562) has the molecular formula C23H25FN8O2S and a molecular weight of 496.57 g/mol. Its IUPAC name is 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(6,6-dioxo-5-propan-2-yl-4,7-dihydropyrazolo[5,1-d][1,2,5]thiadiazin-2-yl)-7-fluoroisoquinoline-3,8-diamine.
| Compound Name | 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(6,6-dioxo-5-propan-2-yl-4,7-dihydropyrazolo[5,1-d][1,2,5]thiadiazin-2-yl)-7-fluoroisoquinoline-3,8-diamine |
|---|---|
| PubChem CID | 135342562 |
| Molecular Formula | C23H25FN8O2S |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(6,6-dioxo-5-propan-2-yl-4,7-dihydropyrazolo[5,1-d][1,2,5]thiadiazin-2-yl)-7-fluoroisoquinoline-3,8-diamine |
| SMILES | Cc1c(N)cncc1-c1cc2cc(Nc3cc4n(n3)CS(=O)(=O)N(C(C)C)C4)ncc2c(N)c1F |
| InChI | InChI=1S/C23H25FN8O2S/c1-12(2)32-10-15-6-21(30-31(15)11-35(32,33)34)29-20-5-14-4-16(17-7-27-9-19(25)13(17)3)22(24)23(26)18(14)8-28-20/h4-9,12H,10-11,25-26H2,1-3H3,(H,28,29,30) |
| InChIKey | YXLUHUIFNMNCGK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 145.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|