C26H26FN7O2 — CID 135342633
2-[[8-amino-7-fluoro-6-(5-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)isoquinolin-3-yl]amino]-6-methyl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one (PubChem CID 135342633) has the molecular formula C26H26FN7O2 and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-[[8-amino-7-fluoro-6-(5-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)isoquinolin-3-yl]amino]-6-methyl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one.
| Compound Name | 2-[[8-amino-7-fluoro-6-(5-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)isoquinolin-3-yl]amino]-6-methyl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 135342633 |
| Molecular Formula | C26H26FN7O2 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[[8-amino-7-fluoro-6-(5-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)isoquinolin-3-yl]amino]-6-methyl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one |
| SMILES | Cc1c(-c2cc3cc(Nc4cc5n(n4)CC(=O)N(C)CC5)ncc3c(N)c2F)ccc2c1NCCO2 |
| InChI | InChI=1S/C26H26FN7O2/c1-14-17(3-4-20-26(14)29-6-8-36-20)18-9-15-10-21(30-12-19(15)25(28)24(18)27)31-22-11-16-5-7-33(2)23(35)13-34(16)32-22/h3-4,9-12,29H,5-8,13,28H2,1-2H3,(H,30,31,32) |
| InChIKey | ZCNTVICWLUTSHM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|