C22H22FN7O2S — CID 135342642
6-(5-amino-4-methyl-3-pyridinyl)-3-N-(7,7-dioxo-4,5,6,8-tetrahydropyrazolo[1,5-c][1,3]thiazepin-2-yl)-7-fluoroisoquinoline-3,8-diamine (PubChem CID 135342642) has the molecular formula C22H22FN7O2S and a molecular weight of 467.53 g/mol. Its IUPAC name is 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(7,7-dioxo-4,5,6,8-tetrahydropyrazolo[1,5-c][1,3]thiazepin-2-yl)-7-fluoroisoquinoline-3,8-diamine.
| Compound Name | 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(7,7-dioxo-4,5,6,8-tetrahydropyrazolo[1,5-c][1,3]thiazepin-2-yl)-7-fluoroisoquinoline-3,8-diamine |
|---|---|
| PubChem CID | 135342642 |
| Molecular Formula | C22H22FN7O2S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 6-(5-amino-4-methyl-3-pyridinyl)-3-N-(7,7-dioxo-4,5,6,8-tetrahydropyrazolo[1,5-c][1,3]thiazepin-2-yl)-7-fluoroisoquinoline-3,8-diamine |
| SMILES | Cc1c(N)cncc1-c1cc2cc(Nc3cc4n(n3)CS(=O)(=O)CCC4)ncc2c(N)c1F |
| InChI | InChI=1S/C22H22FN7O2S/c1-12-16(8-26-10-18(12)24)15-5-13-6-19(27-9-17(13)22(25)21(15)23)28-20-7-14-3-2-4-33(31,32)11-30(14)29-20/h5-10H,2-4,11,24-25H2,1H3,(H,27,28,29) |
| InChIKey | OIHUGMNWCAAWTQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|