C22H21ClN4O2 — CID 135342760
N-[8-amino-7-chloro-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-3-hydroxybicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 135342760) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-[8-amino-7-chloro-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-3-hydroxybicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | N-[8-amino-7-chloro-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-3-hydroxybicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 135342760 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[8-amino-7-chloro-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-3-hydroxybicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | Cc1ccncc1-c1cc2cc(NC(=O)C3C4CC(O)CC43)ncc2c(N)c1Cl |
| InChI | InChI=1S/C22H21ClN4O2/c1-10-2-3-25-8-16(10)15-4-11-5-18(26-9-17(11)21(24)20(15)23)27-22(29)19-13-6-12(28)7-14(13)19/h2-5,8-9,12-14,19,28H,6-7,24H2,1H3,(H,26,27,29) |
| InChIKey | LJCWDPUHNOBSHD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|