About oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate
oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate (PubChem CID 135342866) has the molecular formula C21H22FN5O3
and a molecular weight of 411.44 g/mol. Its IUPAC name is oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate.
Molecular Properties
| Compound Name | oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate |
| PubChem CID | 135342866 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate |
| SMILES | Cc1c(N)cncc1-c1cc2cc(NC(=O)OC3CCOCC3)ncc2c(N)c1F |
| InChI | InChI=1S/C21H22FN5O3/c1-11-15(8-25-10-17(11)23)14-6-12-7-18(26-9-16(12)20(24)19(14)22)27-21(28)30-13-2-4-29-5-3-13/h6-10,13H,2-5,23-24H2,1H3,(H,26,27,28) |
| InChIKey | GGPIVPOCOTXSNM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate?
The IUPAC name of oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate (CID 135342866) is oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate.
What is the SMILES notation for oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate?
The canonical SMILES for oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate is Cc1c(N)cncc1-c1cc2cc(NC(=O)OC3CCOCC3)ncc2c(N)c1F.
What is the InChIKey of oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate?
The InChIKey is GGPIVPOCOTXSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN5O3/c1-11-15(8-25-10-17(11)23)14-6-12-7-18(26-9-16(12)20(24)19(14)22)27-21(28)30-13-2-4-29-5-3-13/h6-10,13H,2-5,23-24H2,1H3,(H,26,27,28).
What are the key properties of oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate?
oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate has a molecular weight of 411.44 g/mol, XLogP of 3.64, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate is sourced from PubChem (CID 135342866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).