C26H27FN8O2 — CID 135342889
2-[[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-7-fluoroisoquinolin-3-yl]amino]-6-propan-2-yl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one (PubChem CID 135342889) has the molecular formula C26H27FN8O2 and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-[[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-7-fluoroisoquinolin-3-yl]amino]-6-propan-2-yl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one.
| Compound Name | 2-[[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-7-fluoroisoquinolin-3-yl]amino]-6-propan-2-yl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 135342889 |
| Molecular Formula | C26H27FN8O2 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-7-fluoroisoquinolin-3-yl]amino]-6-propan-2-yl-5,8-dihydro-4H-pyrazolo[1,5-d][1,4]diazepin-7-one |
| SMILES | CC(C)N1CCc2cc(Nc3cc4cc(-c5cncc6c5OCCN6)c(F)c(N)c4cn3)nn2CC1=O |
| InChI | InChI=1S/C26H27FN8O2/c1-14(2)34-5-3-16-9-22(33-35(16)13-23(34)36)32-21-8-15-7-17(24(27)25(28)18(15)11-31-21)19-10-29-12-20-26(19)37-6-4-30-20/h7-12,14,30H,3-6,13,28H2,1-2H3,(H,31,32,33) |
| InChIKey | PXEUPIMVECJCCU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|