C27H29FN6O3 — CID 135343438
(1R,3R,6S,7S)-3-acetamido-N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 135343438) has the molecular formula C27H29FN6O3 and a molecular weight of 504.57 g/mol. Its IUPAC name is (1R,3R,6S,7S)-3-acetamido-N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,3R,6S,7S)-3-acetamido-N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 135343438 |
| Molecular Formula | C27H29FN6O3 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (1R,3R,6S,7S)-3-acetamido-N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CC(=O)N[C@@H]1CC[C@H]2[C@@H](C1)[C@H]2C(=O)Nc1cc2cc(-c3cnc4c(c3C)NCCO4)c(F)c(N)c2cn1 |
| InChI | InChI=1S/C27H29FN6O3/c1-12-19(10-32-27-25(12)30-5-6-37-27)18-7-14-8-21(31-11-20(14)24(29)23(18)28)34-26(36)22-16-4-3-15(9-17(16)22)33-13(2)35/h7-8,10-11,15-17,22,30H,3-6,9,29H2,1-2H3,(H,33,35)(H,31,34,36)/t15-,16+,17-,22+/m1/s1 |
| InChIKey | CJZAVNMLDKEBTC-SVQXRNPESA-N |
| XLogP | 3.62 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|