C26H31F4N3O — CID 135343516
3-fluoro-N-[2-[2-methyl-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine (PubChem CID 135343516) has the molecular formula C26H31F4N3O and a molecular weight of 477.55 g/mol. Its IUPAC name is 3-fluoro-N-[2-[2-methyl-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[2-methyl-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 135343516 |
| Molecular Formula | C26H31F4N3O |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-fluoro-N-[2-[2-methyl-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
| SMILES | Cc1c(OCCNCCCF)cccc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C26H31F4N3O/c1-17-15-21-20-7-3-4-9-22(20)32-24(21)25(33(17)16-26(28,29)30)19-8-5-10-23(18(19)2)34-14-13-31-12-6-11-27/h3-5,7-10,17,25,31-32H,6,11-16H2,1-2H3/t17-,25-/m1/s1 |
| InChIKey | GRTREOMLNXYRCK-CRICUBBOSA-N |
| XLogP | 5.70 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|