About 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine
8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine (PubChem CID 135343670) has the molecular formula C16H12ClFN4O2
and a molecular weight of 346.75 g/mol. Its IUPAC name is 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine.
Molecular Properties
| Compound Name | 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine |
| PubChem CID | 135343670 |
| Molecular Formula | C16H12ClFN4O2 |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine |
| SMILES | Cc1ncc(-c2cc3cc(N)ncc3c(Cl)c2F)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClFN4O2/c1-7-11(5-20-8(2)16(7)22(23)24)10-3-9-4-13(19)21-6-12(9)14(17)15(10)18/h3-6H,1-2H3,(H2,19,21) |
| InChIKey | UTDWMIQSEBRCRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine?
The IUPAC name of 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine (CID 135343670) is 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine.
What is the SMILES notation for 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine?
The canonical SMILES for 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine is Cc1ncc(-c2cc3cc(N)ncc3c(Cl)c2F)c(C)c1[N+](=O)[O-].
What is the InChIKey of 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine?
The InChIKey is UTDWMIQSEBRCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClFN4O2/c1-7-11(5-20-8(2)16(7)22(23)24)10-3-9-4-13(19)21-6-12(9)14(17)15(10)18/h3-6H,1-2H3,(H2,19,21).
What are the key properties of 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine?
8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine has a molecular weight of 346.75 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(4,6-dimethyl-5-nitro-3-pyridinyl)-7-fluoroisoquinolin-3-amine is sourced from PubChem (CID 135343670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).