C29H37F2N3O3 — CID 135343702
(2S)-3-[(1R,3R)-1-[6-fluoro-3-[2-[3-fluoropropyl(methyl)amino]ethoxy]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid (PubChem CID 135343702) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[6-fluoro-3-[2-[3-fluoropropyl(methyl)amino]ethoxy]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1R,3R)-1-[6-fluoro-3-[2-[3-fluoropropyl(methyl)amino]ethoxy]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135343702 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[6-fluoro-3-[2-[3-fluoropropyl(methyl)amino]ethoxy]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
| SMILES | Cc1c(OCCN(C)CCCF)ccc(F)c1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1C[C@H](C)C(=O)O |
| InChI | InChI=1S/C29H37F2N3O3/c1-18(29(35)36)17-34-19(2)16-22-21-8-5-6-9-24(21)32-27(22)28(34)26-20(3)25(11-10-23(26)31)37-15-14-33(4)13-7-12-30/h5-6,8-11,18-19,28,32H,7,12-17H2,1-4H3,(H,35,36)/t18-,19+,28+/m0/s1 |
| InChIKey | OUWDZJIZWQEYKX-DORSKGMSSA-N |
| XLogP | 5.34 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|