C27H35FN4O3 — CID 135343786
(2S)-3-[(1R,3R)-1-[2-[2-(3-fluoropropylamino)ethoxy]-3-methyl-4-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid (PubChem CID 135343786) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[2-[2-(3-fluoropropylamino)ethoxy]-3-methyl-4-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1R,3R)-1-[2-[2-(3-fluoropropylamino)ethoxy]-3-methyl-4-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135343786 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[2-[2-(3-fluoropropylamino)ethoxy]-3-methyl-4-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
| SMILES | Cc1c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2C[C@H](C)C(=O)O)ccnc1OCCNCCCF |
| InChI | InChI=1S/C27H35FN4O3/c1-17(27(33)34)16-32-18(2)15-22-21-7-4-5-8-23(21)31-24(22)25(32)20-9-12-30-26(19(20)3)35-14-13-29-11-6-10-28/h4-5,7-9,12,17-18,25,29,31H,6,10-11,13-16H2,1-3H3,(H,33,34)/t17-,18+,25+/m0/s1 |
| InChIKey | CLEHWPAJGUZRJR-YYULODDRSA-N |
| XLogP | 4.26 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|