C24H28Cl2N6O4 — CID 135344400
tert-butyl N-[2-[2-[4-[(1R,2R)-2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]pyrazol-1-yl]ethoxy]ethyl]carbamate (PubChem CID 135344400) has the molecular formula C24H28Cl2N6O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-[(1R,2R)-2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]pyrazol-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-[(1R,2R)-2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]pyrazol-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 135344400 |
| Molecular Formula | C24H28Cl2N6O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | tert-butyl N-[2-[2-[4-[(1R,2R)-2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]pyrazol-1-yl]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCn1cc([C@@H]2C[C@H]2C(=O)Nc2cc3cc(Cl)nc(Cl)c3cn2)cn1 |
| InChI | InChI=1S/C24H28Cl2N6O4/c1-24(2,3)36-23(34)27-4-6-35-7-5-32-13-15(11-29-32)16-10-17(16)22(33)31-20-9-14-8-19(25)30-21(26)18(14)12-28-20/h8-9,11-13,16-17H,4-7,10H2,1-3H3,(H,27,34)(H,28,31,33)/t16-,17+/m0/s1 |
| InChIKey | WGEASELDZIVIMW-DLBZAZTESA-N |
| XLogP | 4.42 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|