About N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide
N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide (PubChem CID 135344410) has the molecular formula C12H10ClFN4O
and a molecular weight of 280.69 g/mol. Its IUPAC name is N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide |
| PubChem CID | 135344410 |
| Molecular Formula | C12H10ClFN4O |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide |
| SMILES | Nc1nc(Cl)cc2cc(NC(=O)C3CC3F)ncc12 |
| InChI | InChI=1S/C12H10ClFN4O/c13-9-1-5-2-10(16-4-7(5)11(15)17-9)18-12(19)6-3-8(6)14/h1-2,4,6,8H,3H2,(H2,15,17)(H,16,18,19) |
| InChIKey | MFBFZGZXICIPOU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide?
The IUPAC name of N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide (CID 135344410) is N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide.
What is the SMILES notation for N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide?
The canonical SMILES for N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide is Nc1nc(Cl)cc2cc(NC(=O)C3CC3F)ncc12.
What is the InChIKey of N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide?
The InChIKey is MFBFZGZXICIPOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClFN4O/c13-9-1-5-2-10(16-4-7(5)11(15)17-9)18-12(19)6-3-8(6)14/h1-2,4,6,8H,3H2,(H2,15,17)(H,16,18,19).
What are the key properties of N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide?
N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide has a molecular weight of 280.69 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-fluorocyclopropane-1-carboxamide is sourced from PubChem (CID 135344410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).