C13H8Cl2F3N3O — CID 135344740
N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 135344740) has the molecular formula C13H8Cl2F3N3O and a molecular weight of 350.13 g/mol. Its IUPAC name is N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135344740 |
| Molecular Formula | C13H8Cl2F3N3O |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc2cc(Cl)nc(Cl)c2cn1)C1CC1C(F)(F)F |
| InChI | InChI=1S/C13H8Cl2F3N3O/c14-9-1-5-2-10(19-4-7(5)11(15)20-9)21-12(22)6-3-8(6)13(16,17)18/h1-2,4,6,8H,3H2,(H,19,21,22) |
| InChIKey | LMVAVWLSDVKKIA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|