C25H25N5O2 — CID 135345374
cis-(1S,2R)-N-[8-amino-6-[(1S)-1-hydroxy-1,5-dimethyl-2,3-dihydroinden-4-yl]-2,7-naphthyridin-3-yl]-2-(cyanomethyl)cyclopropane-1-carboxamide (PubChem CID 135345374) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is cis-(1S,2R)-N-[8-amino-6-[(1S)-1-hydroxy-1,5-dimethyl-2,3-dihydroinden-4-yl]-2,7-naphthyridin-3-yl]-2-(cyanomethyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[8-amino-6-[(1S)-1-hydroxy-1,5-dimethyl-2,3-dihydroinden-4-yl]-2,7-naphthyridin-3-yl]-2-(cyanomethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135345374 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | cis-(1S,2R)-N-[8-amino-6-[(1S)-1-hydroxy-1,5-dimethyl-2,3-dihydroinden-4-yl]-2,7-naphthyridin-3-yl]-2-(cyanomethyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc2c(c1-c1cc3cc(NC(=O)[C@H]4C[C@@H]4CC#N)ncc3c(N)n1)CC[C@]2(C)O |
| InChI | InChI=1S/C25H25N5O2/c1-13-3-4-19-16(5-7-25(19,2)32)22(13)20-10-15-11-21(28-12-18(15)23(27)29-20)30-24(31)17-9-14(17)6-8-26/h3-4,10-12,14,17,32H,5-7,9H2,1-2H3,(H2,27,29)(H,28,30,31)/t14-,17-,25-/m0/s1 |
| InChIKey | LITKOMXKJSMILY-LIHGKODYSA-N |
| XLogP | 3.83 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |