About 5,15-bis(2,6-difluorophenyl)porphyrin
5,15-bis(2,6-difluorophenyl)porphyrin (PubChem CID 135345476) has the molecular formula C32H16F4N4
and a molecular weight of 532.50 g/mol. Its IUPAC name is 5,15-bis(2,6-difluorophenyl)porphyrin.
Molecular Properties
| Compound Name | 5,15-bis(2,6-difluorophenyl)porphyrin |
| PubChem CID | 135345476 |
| Molecular Formula | C32H16F4N4 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 5,15-bis(2,6-difluorophenyl)porphyrin |
| SMILES | Fc1cccc(F)c1/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC(=N2)/C=C2/C=CC1=N2 |
| InChI | InChI=1S/C32H16F4N4/c33-21-3-1-4-22(34)29(21)31-25-11-7-17(37-25)15-19-9-13-27(39-19)32(30-23(35)5-2-6-24(30)36)28-14-10-20(40-28)16-18-8-12-26(31)38-18/h1-16H/b17-15-,18-16-,19-15-,20-16-,31-25+,31-26+,32-27+,32-28+ |
| InChIKey | WLZZQWSNRUQMQR-VORMYCGHSA-N |
| XLogP | 7.19 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,15-bis(2,6-difluorophenyl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,15-bis(2,6-difluorophenyl)porphyrin?
The IUPAC name of 5,15-bis(2,6-difluorophenyl)porphyrin (CID 135345476) is 5,15-bis(2,6-difluorophenyl)porphyrin.
What is the SMILES notation for 5,15-bis(2,6-difluorophenyl)porphyrin?
The canonical SMILES for 5,15-bis(2,6-difluorophenyl)porphyrin is Fc1cccc(F)c1/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC(=N2)/C=C2/C=CC1=N2.
What is the InChIKey of 5,15-bis(2,6-difluorophenyl)porphyrin?
The InChIKey is WLZZQWSNRUQMQR-VORMYCGHSA-N. The full InChI is InChI=1S/C32H16F4N4/c33-21-3-1-4-22(34)29(21)31-25-11-7-17(37-25)15-19-9-13-27(39-19)32(30-23(35)5-2-6-24(30)36)28-14-10-20(40-28)16-18-8-12-26(31)38-18/h1-16H/b17-15-,18-16-,19-15-,20-16-,31-25+,31-26+,32-27+,32-28+.
What are the key properties of 5,15-bis(2,6-difluorophenyl)porphyrin?
5,15-bis(2,6-difluorophenyl)porphyrin has a molecular weight of 532.50 g/mol, XLogP of 7.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,15-bis(2,6-difluorophenyl)porphyrin is sourced from PubChem (CID 135345476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).