About dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate
dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate (PubChem CID 135345905) has the molecular formula C33H58O7S4
and a molecular weight of 695.09 g/mol. Its IUPAC name is dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate.
Molecular Properties
| Compound Name | dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate |
| PubChem CID | 135345905 |
| Molecular Formula | C33H58O7S4 |
| Molecular Weight | 695.09 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate |
| SMILES | CCOC(=S)SC(CCCCCCCCC(=O)OC)CCC(=O)CCC(CCCCCCCCC(=O)OC)SC(=S)OCC |
| InChI | InChI=1S/C33H58O7S4/c1-5-39-32(41)43-28(19-15-11-7-9-13-17-21-30(35)37-3)25-23-27(34)24-26-29(44-33(42)40-6-2)20-16-12-8-10-14-18-22-31(36)38-4/h28-29H,5-26H2,1-4H3 |
| InChIKey | SRZMEHDRXINSJM-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 695.09 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate?
The IUPAC name of dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate (CID 135345905) is dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate.
What is the SMILES notation for dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate?
The canonical SMILES for dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate is CCOC(=S)SC(CCCCCCCCC(=O)OC)CCC(=O)CCC(CCCCCCCCC(=O)OC)SC(=S)OCC.
What is the InChIKey of dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate?
The InChIKey is SRZMEHDRXINSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H58O7S4/c1-5-39-32(41)43-28(19-15-11-7-9-13-17-21-30(35)37-3)25-23-27(34)24-26-29(44-33(42)40-6-2)20-16-12-8-10-14-18-22-31(36)38-4/h28-29H,5-26H2,1-4H3.
What are the key properties of dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate?
dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate has a molecular weight of 695.09 g/mol, XLogP of 9.55, 28 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 10,16-bis(ethoxycarbothioylsulfanyl)-13-oxopentacosanedioate is sourced from PubChem (CID 135345905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).