About (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid
(3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid (PubChem CID 135346014) has the molecular formula C13H7BrClF2N3O2
and a molecular weight of 390.57 g/mol. Its IUPAC name is (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid.
Molecular Properties
| Compound Name | (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid |
| PubChem CID | 135346014 |
| Molecular Formula | C13H7BrClF2N3O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(F)c(F)c2c1[nH]c1ncc(Br)c(Cl)c12 |
| InChI | InChI=1S/C13H7BrClF2N3O2/c1-20(13(21)22)6-2-5(16)10(17)8-7-9(15)4(14)3-18-12(7)19-11(6)8/h2-3H,1H3,(H,18,19)(H,21,22) |
| InChIKey | KQQMHUXGBLZLQP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid?
The IUPAC name of (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid (CID 135346014) is (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid.
What is the SMILES notation for (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid?
The canonical SMILES for (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid is CN(C(=O)O)c1cc(F)c(F)c2c1[nH]c1ncc(Br)c(Cl)c12.
What is the InChIKey of (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid?
The InChIKey is KQQMHUXGBLZLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrClF2N3O2/c1-20(13(21)22)6-2-5(16)10(17)8-7-9(15)4(14)3-18-12(7)19-11(6)8/h2-3H,1H3,(H,18,19)(H,21,22).
What are the key properties of (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid?
(3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid has a molecular weight of 390.57 g/mol, XLogP of 4.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-4-chloro-5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-methylcarbamic acid is sourced from PubChem (CID 135346014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).