C34H42N4O6S — CID 135347022
N'-[[4-[2,5-dioxo-1-[6-oxo-6-(prop-2-ynylamino)hexyl]pyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide (PubChem CID 135347022) has the molecular formula C34H42N4O6S and a molecular weight of 634.80 g/mol. Its IUPAC name is N'-[[4-[2,5-dioxo-1-[6-oxo-6-(prop-2-ynylamino)hexyl]pyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide.
| Compound Name | N'-[[4-[2,5-dioxo-1-[6-oxo-6-(prop-2-ynylamino)hexyl]pyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
|---|---|
| PubChem CID | 135347022 |
| Molecular Formula | C34H42N4O6S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | N'-[[4-[2,5-dioxo-1-[6-oxo-6-(prop-2-ynylamino)hexyl]pyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
| SMILES | C#CCNC(=O)CCCCCN1C(=O)CC(Sc2ccc(CONC(=O)CCCCCCC(=O)Nc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C34H42N4O6S/c1-2-22-35-30(39)15-11-6-12-23-38-33(42)24-29(34(38)43)45-28-20-18-26(19-21-28)25-44-37-32(41)17-10-4-3-9-16-31(40)36-27-13-7-5-8-14-27/h1,5,7-8,13-14,18-21,29H,3-4,6,9-12,15-17,22-25H2,(H,35,39)(H,36,40)(H,37,41) |
| InChIKey | BDZULQWFYDXGGY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|