About 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride
1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride (PubChem CID 135347545) has the molecular formula C12H22ClN5
and a molecular weight of 271.80 g/mol. Its IUPAC name is 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride |
| PubChem CID | 135347545 |
| Molecular Formula | C12H22ClN5 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride |
| SMILES | Cl.c1n[nH]c(C2CCN(C3CCNCC3)CC2)n1 |
| InChI | InChI=1S/C12H21N5.ClH/c1-5-13-6-2-11(1)17-7-3-10(4-8-17)12-14-9-15-16-12;/h9-11,13H,1-8H2,(H,14,15,16);1H |
| InChIKey | XPRLASBXJASMIR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride?
The IUPAC name of 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride (CID 135347545) is 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride.
What is the SMILES notation for 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride?
The canonical SMILES for 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride is Cl.c1n[nH]c(C2CCN(C3CCNCC3)CC2)n1.
What is the InChIKey of 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride?
The InChIKey is XPRLASBXJASMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5.ClH/c1-5-13-6-2-11(1)17-7-3-10(4-8-17)12-14-9-15-16-12;/h9-11,13H,1-8H2,(H,14,15,16);1H.
What are the key properties of 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride?
1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride has a molecular weight of 271.80 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-4-(1H-1,2,4-triazol-5-yl)piperidine;hydrochloride is sourced from PubChem (CID 135347545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).