About cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol
cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol (PubChem CID 135347843) has the molecular formula C10H13F3N2O2
and a molecular weight of 250.22 g/mol. Its IUPAC name is cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol.
Molecular Properties
| Compound Name | cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol |
| PubChem CID | 135347843 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol |
| SMILES | OC(C1CCC1)n1ccc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O2/c11-10(12,13)6-17-8-4-5-15(14-8)9(16)7-2-1-3-7/h4-5,7,9,16H,1-3,6H2 |
| InChIKey | MCYLYFNAENJYPS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol?
The IUPAC name of cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol (CID 135347843) is cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol.
What is the SMILES notation for cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol?
The canonical SMILES for cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol is OC(C1CCC1)n1ccc(OCC(F)(F)F)n1.
What is the InChIKey of cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol?
The InChIKey is MCYLYFNAENJYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O2/c11-10(12,13)6-17-8-4-5-15(14-8)9(16)7-2-1-3-7/h4-5,7,9,16H,1-3,6H2.
What are the key properties of cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol?
cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol has a molecular weight of 250.22 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-[3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]methanol is sourced from PubChem (CID 135347843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).