About US11345676, Example 2
US11345676, Example 2 (PubChem CID 135347967) has the molecular formula C24H18F3N7O2
and a molecular weight of 493.40 g/mol. Its IUPAC name is 3-[[4-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide.
Molecular Properties
| Compound Name | US11345676, Example 2 |
| PubChem CID | 135347967 |
| Molecular Formula | C24H18F3N7O2 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-[[4-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide |
| SMILES | CC(C)N1C=NN=C1C2=NC(=CC=C2)NC(=O)C3=CC(=CC=C3)OC4=CC(=CC(=N4)C(F)(F)F)C#N |
| InChI | InChI=1S/C24H18F3N7O2/c1-14(2)34-13-29-33-22(34)18-7-4-8-20(30-18)32-23(35)16-5-3-6-17(11-16)36-21-10-15(12-28)9-19(31-21)24(25,26)27/h3-11,13-14H,1-2H3,(H,30,32,35) |
| InChIKey | JXMPXXPSHNTASD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | 804 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US11345676, Example 2 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US11345676, Example 2?
The IUPAC name of US11345676, Example 2 (CID 135347967) is 3-[[4-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide.
What is the SMILES notation for US11345676, Example 2?
The canonical SMILES for US11345676, Example 2 is CC(C)N1C=NN=C1C2=NC(=CC=C2)NC(=O)C3=CC(=CC=C3)OC4=CC(=CC(=N4)C(F)(F)F)C#N.
What is the InChIKey of US11345676, Example 2?
The InChIKey is JXMPXXPSHNTASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F3N7O2/c1-14(2)34-13-29-33-22(34)18-7-4-8-20(30-18)32-23(35)16-5-3-6-17(11-16)36-21-10-15(12-28)9-19(31-21)24(25,26)27/h3-11,13-14H,1-2H3,(H,30,32,35).
What are the key properties of US11345676, Example 2?
US11345676, Example 2 has a molecular weight of 493.40 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US11345676, Example 2 is sourced from PubChem (CID 135347967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).