About (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol
(1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (PubChem CID 135348285) has the molecular formula C8H5BrClF3O
and a molecular weight of 289.48 g/mol. Its IUPAC name is (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| PubChem CID | 135348285 |
| Molecular Formula | C8H5BrClF3O |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| SMILES | O[C@@H](c1ccc(Cl)c(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C8H5BrClF3O/c9-5-3-4(1-2-6(5)10)7(14)8(11,12)13/h1-3,7,14H/t7-/m0/s1 |
| InChIKey | ONTXDZYLWLEIBL-ZETCQYMHSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol?
The IUPAC name of (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CID 135348285) is (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol.
What is the SMILES notation for (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol?
The canonical SMILES for (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol is O[C@@H](c1ccc(Cl)c(Br)c1)C(F)(F)F.
What is the InChIKey of (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol?
The InChIKey is ONTXDZYLWLEIBL-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H5BrClF3O/c9-5-3-4(1-2-6(5)10)7(14)8(11,12)13/h1-3,7,14H/t7-/m0/s1.
What are the key properties of (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol?
(1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol has a molecular weight of 289.48 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(3-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol is sourced from PubChem (CID 135348285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).