C7H11N3O2 — CID 135349343
1-ethyl-5-methoxypyrazole-4-carboxamide (PubChem CID 135349343) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-ethyl-5-methoxypyrazole-4-carboxamide.
| Compound Name | 1-ethyl-5-methoxypyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135349343 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-ethyl-5-methoxypyrazole-4-carboxamide |
| SMILES | CCn1ncc(C(N)=O)c1OC |
| InChI | InChI=1S/C7H11N3O2/c1-3-10-7(12-2)5(4-9-10)6(8)11/h4H,3H2,1-2H3,(H2,8,11) |
| InChIKey | KKDIMKTWPIUAFL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |