C24H23FN2O3 — CID 135349551
butyl 3-fluoro-4-[2-(isoquinolin-6-ylcarbamoyl)cyclopropyl]benzoate (PubChem CID 135349551) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is butyl 3-fluoro-4-[2-(isoquinolin-6-ylcarbamoyl)cyclopropyl]benzoate.
| Compound Name | butyl 3-fluoro-4-[2-(isoquinolin-6-ylcarbamoyl)cyclopropyl]benzoate |
|---|---|
| PubChem CID | 135349551 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | butyl 3-fluoro-4-[2-(isoquinolin-6-ylcarbamoyl)cyclopropyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(C2CC2C(=O)Nc2ccc3cnccc3c2)c(F)c1 |
| InChI | InChI=1S/C24H23FN2O3/c1-2-3-10-30-24(29)16-5-7-19(22(25)12-16)20-13-21(20)23(28)27-18-6-4-17-14-26-9-8-15(17)11-18/h4-9,11-12,14,20-21H,2-3,10,13H2,1H3,(H,27,28) |
| InChIKey | BCKKEZVMTKWQNM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|