C16H30N4 — CID 135349838
2-[4-(2,4-diaminopentan-2-yl)phenyl]pentane-2,4-diamine (PubChem CID 135349838) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[4-(2,4-diaminopentan-2-yl)phenyl]pentane-2,4-diamine.
| Compound Name | 2-[4-(2,4-diaminopentan-2-yl)phenyl]pentane-2,4-diamine |
|---|---|
| PubChem CID | 135349838 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2-[4-(2,4-diaminopentan-2-yl)phenyl]pentane-2,4-diamine |
| SMILES | CC(N)CC(C)(N)c1ccc(C(C)(N)CC(C)N)cc1 |
| InChI | InChI=1S/C16H30N4/c1-11(17)9-15(3,19)13-5-7-14(8-6-13)16(4,20)10-12(2)18/h5-8,11-12H,9-10,17-20H2,1-4H3 |
| InChIKey | JEVSOORWGAMJSP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |