C43H41N5O5 — CID 135350003
2-hydroxy-N-[4-[6-[1-hydroxy-3-oxo-2-(3-phenoxyphenyl)isoindol-1-yl]-1H-benzimidazol-2-yl]-4-piperidin-1-ylbutyl]benzamide (PubChem CID 135350003) has the molecular formula C43H41N5O5 and a molecular weight of 707.83 g/mol. Its IUPAC name is 2-hydroxy-N-[4-[6-[1-hydroxy-3-oxo-2-(3-phenoxyphenyl)isoindol-1-yl]-1H-benzimidazol-2-yl]-4-piperidin-1-ylbutyl]benzamide.
| Compound Name | 2-hydroxy-N-[4-[6-[1-hydroxy-3-oxo-2-(3-phenoxyphenyl)isoindol-1-yl]-1H-benzimidazol-2-yl]-4-piperidin-1-ylbutyl]benzamide |
|---|---|
| PubChem CID | 135350003 |
| Molecular Formula | C43H41N5O5 |
| Molecular Weight | 707.83 g/mol |
| Exact Mass | 707.31 |
| IUPAC Name | 2-hydroxy-N-[4-[6-[1-hydroxy-3-oxo-2-(3-phenoxyphenyl)isoindol-1-yl]-1H-benzimidazol-2-yl]-4-piperidin-1-ylbutyl]benzamide |
| SMILES | O=C(NCCCC(c1nc2ccc(C3(O)c4ccccc4C(=O)N3c3cccc(Oc4ccccc4)c3)cc2[nH]1)N1CCCCC1)c1ccccc1O |
| InChI | InChI=1S/C43H41N5O5/c49-39-21-8-6-18-34(39)41(50)44-24-12-20-38(47-25-9-2-10-26-47)40-45-36-23-22-29(27-37(36)46-40)43(52)35-19-7-5-17-33(35)42(51)48(43)30-13-11-16-32(28-30)53-31-14-3-1-4-15-31/h1,3-8,11,13-19,21-23,27-28,38,49,52H,2,9-10,12,20,24-26H2,(H,44,50)(H,45,46) |
| InChIKey | NGPPTYBPBPMFFS-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 131.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.83 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|