About 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one
4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one (PubChem CID 135350064) has the molecular formula C28H27N3O4
and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one |
| PubChem CID | 135350064 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one |
| SMILES | COc1ccc2c(Oc3ccc(N4CCN(Cc5ccccc5)CC4=O)cc3)ccnc2c1OC |
| InChI | InChI=1S/C28H27N3O4/c1-33-25-13-12-23-24(14-15-29-27(23)28(25)34-2)35-22-10-8-21(9-11-22)31-17-16-30(19-26(31)32)18-20-6-4-3-5-7-20/h3-15H,16-19H2,1-2H3 |
| InChIKey | LJVWDEKOKUZNMQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one?
The IUPAC name of 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one (CID 135350064) is 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one.
What is the SMILES notation for 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one?
The canonical SMILES for 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one is COc1ccc2c(Oc3ccc(N4CCN(Cc5ccccc5)CC4=O)cc3)ccnc2c1OC.
What is the InChIKey of 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one?
The InChIKey is LJVWDEKOKUZNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O4/c1-33-25-13-12-23-24(14-15-29-27(23)28(25)34-2)35-22-10-8-21(9-11-22)31-17-16-30(19-26(31)32)18-20-6-4-3-5-7-20/h3-15H,16-19H2,1-2H3.
What are the key properties of 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one?
4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one has a molecular weight of 469.54 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-[4-(7,8-dimethoxyquinolin-4-yl)oxyphenyl]piperazin-2-one is sourced from PubChem (CID 135350064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).