About 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid
4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 135350364) has the molecular formula C13H21NO3S
and a molecular weight of 271.38 g/mol. Its IUPAC name is 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 135350364 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1=CCC(C2CCN(C)CC2)(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C13H21NO3S/c1-11-3-7-13(8-4-11,18(15,16)17)12-5-9-14(2)10-6-12/h3-4,7,12H,5-6,8-10H2,1-2H3,(H,15,16,17) |
| InChIKey | AQMKXOVTSOFYLC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid (CID 135350364) is 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid is CC1=CCC(C2CCN(C)CC2)(S(=O)(=O)O)C=C1.
What is the InChIKey of 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is AQMKXOVTSOFYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3S/c1-11-3-7-13(8-4-11,18(15,16)17)12-5-9-14(2)10-6-12/h3-4,7,12H,5-6,8-10H2,1-2H3,(H,15,16,17).
What are the key properties of 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid?
4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 271.38 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(1-methylpiperidin-4-yl)cyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 135350364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).