About 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole
6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole (PubChem CID 135350410) has the molecular formula C10H11FN2O2
and a molecular weight of 210.21 g/mol. Its IUPAC name is 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole.
Molecular Properties
| Compound Name | 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole |
| PubChem CID | 135350410 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole |
| SMILES | CC1(C)NCc2c1ccc(F)c2[N+](=O)[O-] |
| InChI | InChI=1S/C10H11FN2O2/c1-10(2)7-3-4-8(11)9(13(14)15)6(7)5-12-10/h3-4,12H,5H2,1-2H3 |
| InChIKey | GCGMJZUSAFJOPE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole?
The IUPAC name of 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole (CID 135350410) is 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole.
What is the SMILES notation for 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole?
The canonical SMILES for 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole is CC1(C)NCc2c1ccc(F)c2[N+](=O)[O-].
What is the InChIKey of 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole?
The InChIKey is GCGMJZUSAFJOPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O2/c1-10(2)7-3-4-8(11)9(13(14)15)6(7)5-12-10/h3-4,12H,5H2,1-2H3.
What are the key properties of 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole?
6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole has a molecular weight of 210.21 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroisoindole is sourced from PubChem (CID 135350410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).