C13H15ClN4O3 — CID 135351170
methyl 4-[(4-amino-1-methylimidazole-2-carbonyl)amino]benzoate;hydrochloride (PubChem CID 135351170) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is methyl 4-[(4-amino-1-methylimidazole-2-carbonyl)amino]benzoate;hydrochloride.
| Compound Name | methyl 4-[(4-amino-1-methylimidazole-2-carbonyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 135351170 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl 4-[(4-amino-1-methylimidazole-2-carbonyl)amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(NC(=O)c2nc(N)cn2C)cc1.Cl |
| InChI | InChI=1S/C13H14N4O3.ClH/c1-17-7-10(14)16-11(17)12(18)15-9-5-3-8(4-6-9)13(19)20-2;/h3-7H,14H2,1-2H3,(H,15,18);1H |
| InChIKey | HNASKLXPHCLPHF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |