C30H33F3N6O5S2 — CID 135352220
N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135352220) has the molecular formula C30H33F3N6O5S2 and a molecular weight of 678.76 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135352220 |
| Molecular Formula | C30H33F3N6O5S2 |
| Molecular Weight | 678.76 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(c2)OCCC3N2CC[C@@H](C(F)(F)F)C[C@H]2c2ccnn2C)c(OC)c1 |
| InChI | InChI=1S/C30H33F3N6O5S2/c1-37-25(8-11-35-37)26-14-20(30(31,32)33)9-12-38(26)24-10-13-44-28-16-22(6-7-23(24)28)46(40,41)39(29-34-18-36-45-29)17-19-4-5-21(42-2)15-27(19)43-3/h4-8,11,15-16,18,20,24,26H,9-10,12-14,17H2,1-3H3/t20-,24?,26+/m1/s1 |
| InChIKey | DXIBTPZYVMCBCN-BJKPWLCLSA-N |
| XLogP | 5.52 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |