C19H13F8N3O2 — CID 135352293
(3R,4S)-N'-[2,3-difluoro-4-(trifluoromethyl)phenyl]-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide (PubChem CID 135352293) has the molecular formula C19H13F8N3O2 and a molecular weight of 467.32 g/mol. Its IUPAC name is (3R,4S)-N'-[2,3-difluoro-4-(trifluoromethyl)phenyl]-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide.
| Compound Name | (3R,4S)-N'-[2,3-difluoro-4-(trifluoromethyl)phenyl]-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 135352293 |
| Molecular Formula | C19H13F8N3O2 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (3R,4S)-N'-[2,3-difluoro-4-(trifluoromethyl)phenyl]-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
| SMILES | O=C1NC[C@H](c2cccc(C(F)(F)F)c2)[C@H]1C(=O)NNc1ccc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C19H13F8N3O2/c20-14-11(19(25,26)27)4-5-12(15(14)21)29-30-17(32)13-10(7-28-16(13)31)8-2-1-3-9(6-8)18(22,23)24/h1-6,10,13,29H,7H2,(H,28,31)(H,30,32)/t10-,13-/m1/s1 |
| InChIKey | PHOIMNQIIIAKFJ-ZWNOBZJWSA-N |
| XLogP | 3.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|