C21H24FN3O4S — CID 135352581
5-ethoxy-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 135352581) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | 5-ethoxy-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 135352581 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 5-ethoxy-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CCOc1ccc2c(c1)C(N(CC(C)C)/N=C/c1ccc(F)c(OC)c1)=NS2(=O)=O |
| InChI | InChI=1S/C21H24FN3O4S/c1-5-29-16-7-9-20-17(11-16)21(24-30(20,26)27)25(13-14(2)3)23-12-15-6-8-18(22)19(10-15)28-4/h6-12,14H,5,13H2,1-4H3/b23-12+ |
| InChIKey | BRZCTLXZSZRDLW-FSJBWODESA-N |
| XLogP | 3.67 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|