C19H20FN3O4S — CID 135352582
N-(2-ethoxyethyl)-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 135352582) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(2-ethoxyethyl)-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 135352582 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(2-ethoxyethyl)-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CCOCCN(/N=C/c1ccc(F)c(OC)c1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H20FN3O4S/c1-3-27-11-10-23(21-13-14-8-9-16(20)17(12-14)26-2)19-15-6-4-5-7-18(15)28(24,25)22-19/h4-9,12-13H,3,10-11H2,1-2H3/b21-13+ |
| InChIKey | KSUWWHGYIYMHCP-FYJGNVAPSA-N |
| XLogP | 2.66 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|