C23H29FN3O6PS — CID 135352591
6-diethoxyphosphoryl-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 135352591) has the molecular formula C23H29FN3O6PS and a molecular weight of 525.54 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | 6-diethoxyphosphoryl-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 135352591 |
| Molecular Formula | C23H29FN3O6PS |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 6-diethoxyphosphoryl-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-N-(2-methylpropyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CCOP(=O)(OCC)c1ccc2c(c1)S(=O)(=O)N=C2N(CC(C)C)/N=C/c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C23H29FN3O6PS/c1-6-32-34(28,33-7-2)18-9-10-19-22(13-18)35(29,30)26-23(19)27(15-16(3)4)25-14-17-8-11-20(24)21(12-17)31-5/h8-14,16H,6-7,15H2,1-5H3/b25-14+ |
| InChIKey | RVAOINOKUORANR-AFUMVMLFSA-N |
| XLogP | 4.17 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|