C19H19ClFN3O4S — CID 135352609
2-(chloromethyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]propan-1-ol (PubChem CID 135352609) has the molecular formula C19H19ClFN3O4S and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]propan-1-ol.
| Compound Name | 2-(chloromethyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]propan-1-ol |
|---|---|
| PubChem CID | 135352609 |
| Molecular Formula | C19H19ClFN3O4S |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-(chloromethyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]propan-1-ol |
| SMILES | COc1cc(/C=N/N(CC(CO)CCl)C2=NS(=O)(=O)c3ccccc32)ccc1F |
| InChI | InChI=1S/C19H19ClFN3O4S/c1-28-17-8-13(6-7-16(17)21)10-22-24(11-14(9-20)12-25)19-15-4-2-3-5-18(15)29(26,27)23-19/h2-8,10,14,25H,9,11-12H2,1H3/b22-10+ |
| InChIKey | SVGMGKGKIQTTLO-LSHDLFTRSA-N |
| XLogP | 2.47 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|