About 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine
6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 135352716) has the molecular formula C15H11BrFN3O2S
and a molecular weight of 396.24 g/mol. Its IUPAC name is 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine |
| PubChem CID | 135352716 |
| Molecular Formula | C15H11BrFN3O2S |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CN(/N=C/c1ccc(F)cc1)C1=NS(=O)(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H11BrFN3O2S/c1-20(18-9-10-2-5-12(17)6-3-10)15-13-7-4-11(16)8-14(13)23(21,22)19-15/h2-9H,1H3/b18-9+ |
| InChIKey | XWVNVNSNGKYZNZ-GIJQJNRQSA-N |
| XLogP | 3.00 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The IUPAC name of 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine (CID 135352716) is 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine.
What is the SMILES notation for 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The canonical SMILES for 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine is CN(/N=C/c1ccc(F)cc1)C1=NS(=O)(=O)c2cc(Br)ccc21.
What is the InChIKey of 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The InChIKey is XWVNVNSNGKYZNZ-GIJQJNRQSA-N. The full InChI is InChI=1S/C15H11BrFN3O2S/c1-20(18-9-10-2-5-12(17)6-3-10)15-13-7-4-11(16)8-14(13)23(21,22)19-15/h2-9H,1H3/b18-9+.
What are the key properties of 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine?
6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine has a molecular weight of 396.24 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-N-methyl-1,1-dioxo-1,2-benzothiazol-3-amine is sourced from PubChem (CID 135352716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).