C37H54N4O9 — CID 135353004
tert-butyl (4R)-5-[4-hydroxy-3-[[3-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 135353004) has the molecular formula C37H54N4O9 and a molecular weight of 698.86 g/mol. Its IUPAC name is tert-butyl (4R)-5-[4-hydroxy-3-[[3-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl (4R)-5-[4-hydroxy-3-[[3-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 135353004 |
| Molecular Formula | C37H54N4O9 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.39 |
| IUPAC Name | tert-butyl (4R)-5-[4-hydroxy-3-[[3-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C[C@H](Cc1ccc(O)c(NC(=O)C(NC(=O)C(C)NC(=O)OCc2ccccc2)C(C)C)c1)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H54N4O9/c1-22(2)30(41-31(43)24(4)38-34(46)48-21-25-14-12-11-13-15-25)32(44)40-28-20-26(16-17-29(28)42)19-27(39-35(47)50-37(8,9)10)18-23(3)33(45)49-36(5,6)7/h11-17,20,22-24,27,30,42H,18-19,21H2,1-10H3,(H,38,46)(H,39,47)(H,40,44)(H,41,43)/t23?,24?,27-,30?/m1/s1 |
| InChIKey | RECWGKXTYYZFKC-LVFXZEGXSA-N |
| XLogP | 5.59 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|