About (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid
(E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid (PubChem CID 135353629) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid.
Molecular Properties
| Compound Name | (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid |
| PubChem CID | 135353629 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid |
| SMILES | CC1CCCC1(C)/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O4/c1-7-4-3-5-11(7,2)8(10(14)15)6-9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13)(H,14,15)/b8-6- |
| InChIKey | GUSKJWFLMHWLDM-VURMDHGXSA-N |
| XLogP | 1.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid?
The IUPAC name of (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid (CID 135353629) is (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid.
What is the SMILES notation for (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid?
The canonical SMILES for (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid is CC1CCCC1(C)/C(=C\C(=O)O)C(=O)O.
What is the InChIKey of (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid?
The InChIKey is GUSKJWFLMHWLDM-VURMDHGXSA-N. The full InChI is InChI=1S/C11H16O4/c1-7-4-3-5-11(7,2)8(10(14)15)6-9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13)(H,14,15)/b8-6-.
What are the key properties of (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid?
(E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid has a molecular weight of 212.24 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(1,2-dimethylcyclopentyl)but-2-enedioic acid is sourced from PubChem (CID 135353629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).