C14H15NO3S — CID 135353747
(1S,2S,3S,4R)-3-[methyl(thiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 135353747) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[methyl(thiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[methyl(thiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 135353747 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (1S,2S,3S,4R)-3-[methyl(thiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CN(C(=O)[C@@H]1[C@@H](C(=O)O)[C@@H]2C=C[C@H]1C2)c1cccs1 |
| InChI | InChI=1S/C14H15NO3S/c1-15(10-3-2-6-19-10)13(16)11-8-4-5-9(7-8)12(11)14(17)18/h2-6,8-9,11-12H,7H2,1H3,(H,17,18)/t8-,9+,11-,12-/m0/s1 |
| InChIKey | UOJHOVMLBJJENU-QCMRWSPLSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|