C9H18O2 — CID 135353779
(4R,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxane (PubChem CID 135353779) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (4R,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxane.
| Compound Name | (4R,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 135353779 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (4R,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxane |
| SMILES | CC[C@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C9H18O2/c1-5-8-7(2)6-10-9(3,4)11-8/h7-8H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | DAGVUUWZVMSKOY-HTQZYQBOSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |