C18H22N2O — CID 135353952
3-cycloheptyl-2,4-dihydropyrido[3,2-h][1,3]benzoxazine (PubChem CID 135353952) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-cycloheptyl-2,4-dihydropyrido[3,2-h][1,3]benzoxazine.
| Compound Name | 3-cycloheptyl-2,4-dihydropyrido[3,2-h][1,3]benzoxazine |
|---|---|
| PubChem CID | 135353952 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-cycloheptyl-2,4-dihydropyrido[3,2-h][1,3]benzoxazine |
| SMILES | c1cnc2c3c(ccc2c1)CN(C1CCCCCC1)CO3 |
| InChI | InChI=1S/C18H22N2O/c1-2-4-8-16(7-3-1)20-12-15-10-9-14-6-5-11-19-17(14)18(15)21-13-20/h5-6,9-11,16H,1-4,7-8,12-13H2 |
| InChIKey | MKHUZLZAYLHAQB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |