C18H22N2O — CID 135353973
3-(cyclohexylmethyl)-2,4-dihydropyrido[3,2-h][1,3]benzoxazine (PubChem CID 135353973) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-2,4-dihydropyrido[3,2-h][1,3]benzoxazine.
| Compound Name | 3-(cyclohexylmethyl)-2,4-dihydropyrido[3,2-h][1,3]benzoxazine |
|---|---|
| PubChem CID | 135353973 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-(cyclohexylmethyl)-2,4-dihydropyrido[3,2-h][1,3]benzoxazine |
| SMILES | c1cnc2c3c(ccc2c1)CN(CC1CCCCC1)CO3 |
| InChI | InChI=1S/C18H22N2O/c1-2-5-14(6-3-1)11-20-12-16-9-8-15-7-4-10-19-17(15)18(16)21-13-20/h4,7-10,14H,1-3,5-6,11-13H2 |
| InChIKey | MBTVIQNLVDGUNC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |