C25H27F2N5O3 — CID 135354429
N-[6-[[(1S,3S,5S)-2-(2,2-difluoroethyl)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]-2,2-dimethyl-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 135354429) has the molecular formula C25H27F2N5O3 and a molecular weight of 483.52 g/mol. Its IUPAC name is N-[6-[[(1S,3S,5S)-2-(2,2-difluoroethyl)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]-2,2-dimethyl-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[6-[[(1S,3S,5S)-2-(2,2-difluoroethyl)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]-2,2-dimethyl-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135354429 |
| Molecular Formula | C25H27F2N5O3 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[6-[[(1S,3S,5S)-2-(2,2-difluoroethyl)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]-2,2-dimethyl-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC1(C)Cc2cc(NC(=O)c3cnn4cccnc34)c(OC[C@@H]3C[C@@H]4C[C@@H]4N3CC(F)F)cc2O1 |
| InChI | InChI=1S/C25H27F2N5O3/c1-25(2)10-15-7-18(30-24(33)17-11-29-32-5-3-4-28-23(17)32)21(9-20(15)35-25)34-13-16-6-14-8-19(14)31(16)12-22(26)27/h3-5,7,9,11,14,16,19,22H,6,8,10,12-13H2,1-2H3,(H,30,33)/t14-,16+,19+/m1/s1 |
| InChIKey | WRFWRDLEDJNYFV-ALKREAHSSA-N |
| XLogP | 3.80 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |