C28H27ClN10O7 — CID 135354867
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-4-nitropyrazole-3-carboxamide;ethyl 4-nitro-1H-pyrazole-5-carboxylate (PubChem CID 135354867) has the molecular formula C28H27ClN10O7 and a molecular weight of 651.04 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-4-nitropyrazole-3-carboxamide;ethyl 4-nitro-1H-pyrazole-5-carboxylate.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-4-nitropyrazole-3-carboxamide;ethyl 4-nitro-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135354867 |
| Molecular Formula | C28H27ClN10O7 |
| Molecular Weight | 651.04 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-4-nitropyrazole-3-carboxamide;ethyl 4-nitro-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]ncc1[N+](=O)[O-].Cc1cc(N)nc(C)c1CNC(=O)c1nn(Cc2ccc3ncc(Cl)cc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20ClN7O3.C6H7N3O4/c1-12-5-20(24)27-13(2)17(12)9-26-22(31)21-19(30(32)33)11-29(28-21)10-14-3-4-18-15(6-14)7-16(23)8-25-18;1-2-13-6(10)5-4(9(11)12)3-7-8-5/h3-8,11H,9-10H2,1-2H3,(H2,24,27)(H,26,31);3H,2H2,1H3,(H,7,8) |
| InChIKey | AJGDSNXCLKMLKP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 239.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|