C18H11ClF5N3O2 — CID 135354944
7-chloro-1-(2,6-difluorophenyl)-4-oxo-N-(1,1,1-trifluoropropan-2-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354944) has the molecular formula C18H11ClF5N3O2 and a molecular weight of 431.75 g/mol. Its IUPAC name is 7-chloro-1-(2,6-difluorophenyl)-4-oxo-N-(1,1,1-trifluoropropan-2-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-chloro-1-(2,6-difluorophenyl)-4-oxo-N-(1,1,1-trifluoropropan-2-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354944 |
| Molecular Formula | C18H11ClF5N3O2 |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 7-chloro-1-(2,6-difluorophenyl)-4-oxo-N-(1,1,1-trifluoropropan-2-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cn(-c2c(F)cccc2F)c2nc(Cl)ccc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C18H11ClF5N3O2/c1-8(18(22,23)24)25-17(29)10-7-27(14-11(20)3-2-4-12(14)21)16-9(15(10)28)5-6-13(19)26-16/h2-8H,1H3,(H,25,29) |
| InChIKey | NVFQKZKQLYECQR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|