About (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride
(2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride (PubChem CID 135355035) has the molecular formula C6H13ClF3N
and a molecular weight of 191.62 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride |
| PubChem CID | 135355035 |
| Molecular Formula | C6H13ClF3N |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride |
| SMILES | CC(C)C[C@@H](N)C(F)(F)F.Cl |
| InChI | InChI=1S/C6H12F3N.ClH/c1-4(2)3-5(10)6(7,8)9;/h4-5H,3,10H2,1-2H3;1H/t5-;/m1./s1 |
| InChIKey | NZDUKJWTICUELS-NUBCRITNSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride?
The IUPAC name of (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride (CID 135355035) is (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride.
What is the SMILES notation for (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride?
The canonical SMILES for (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride is CC(C)C[C@@H](N)C(F)(F)F.Cl.
What is the InChIKey of (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride?
The InChIKey is NZDUKJWTICUELS-NUBCRITNSA-N. The full InChI is InChI=1S/C6H12F3N.ClH/c1-4(2)3-5(10)6(7,8)9;/h4-5H,3,10H2,1-2H3;1H/t5-;/m1./s1.
What are the key properties of (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride?
(2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride has a molecular weight of 191.62 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,1-trifluoro-4-methylpentan-2-amine;hydrochloride is sourced from PubChem (CID 135355035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).