C22H29BrN4O4 — CID 135355788
tert-butyl 8-bromo-5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 135355788) has the molecular formula C22H29BrN4O4 and a molecular weight of 493.40 g/mol. Its IUPAC name is tert-butyl 8-bromo-5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 8-bromo-5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 135355788 |
| Molecular Formula | C22H29BrN4O4 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | tert-butyl 8-bromo-5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(Br)ccc2C(NC(=O)c2noc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C22H29BrN4O4/c1-21(2,3)19-25-17(26-31-19)18(28)24-16-12-27(20(29)30-22(4,5)6)10-9-13-11-14(23)7-8-15(13)16/h7-8,11,16H,9-10,12H2,1-6H3,(H,24,28) |
| InChIKey | PBYQFLISWVWJLB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |